16019-85-5 Usage
General Description
2-(4-Phenyl-1-piperidinyl)-3-pyridinamine is a chemical compound with the molecular formula C19H20N4. It is a selective serotonin 5-HT1 receptor agonist, which means it acts on specific receptors in the brain to produce its effects. 2-(4-Phenyl-1-piperidinyl)-3-pyridinamine has been studied for its potential use in the treatment of various psychiatric and neurological disorders, including depression, anxiety, and migraines. It is also being researched for its potential role in the management of substance abuse and addiction. However, further research is needed to fully understand its pharmacological properties and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 16019-85-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,0,1 and 9 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 16019-85:
(7*1)+(6*6)+(5*0)+(4*1)+(3*9)+(2*8)+(1*5)=95
95 % 10 = 5
So 16019-85-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H19N3/c17-15-7-4-10-18-16(15)19-11-8-14(9-12-19)13-5-2-1-3-6-13/h1-7,10,14H,8-9,11-12,17H2