16045-72-0 Usage
Uses
Used in Analytical Chemistry:
Creatinine zinc chloride is used as a reagent in analytical chemistry for its potential to enhance the detection and measurement of creatinine levels in various samples. This can be particularly useful in assessing renal function and diagnosing related conditions.
Used in Biomedical Research:
In biomedical research, creatinine zinc chloride is employed as a compound for studying the metabolism of creatine and its breakdown products, as well as the role of zinc in biological systems. It may also contribute to the development of new diagnostic tools and therapeutic approaches related to renal function.
Used in the Development of New Materials and Compounds:
Creatinine zinc chloride is used as a precursor in the synthesis of new materials and compounds, leveraging the unique properties of both creatinine and zinc chloride. This can lead to innovations in various scientific fields, including pharmaceuticals, materials science, and nanotechnology.
Used in Industrial Processes:
In certain industrial applications, creatinine zinc chloride may be utilized for its specific chemical properties, such as in the manufacturing of certain products or in processes that require the unique combination of its constituent elements. This can contribute to the efficiency and effectiveness of these processes.
Check Digit Verification of cas no
The CAS Registry Mumber 16045-72-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,0,4 and 5 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 16045-72:
(7*1)+(6*6)+(5*0)+(4*4)+(3*5)+(2*7)+(1*2)=90
90 % 10 = 0
So 16045-72-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H9N3O2.2ClH.Zn/c1-7(4(5)6)2-3(8)9;;;/h2H2,1H3,(H3,5,6)(H,8,9);2*1H;/q;;;+2/p-2
