1605-78-3 Usage
Uses
Used in Pharmaceutical Industry:
5,7-Dimethylpyrazolo[1,5-a]pyrimidin-2-amine is used as a potential medicinal compound for its anti-cancer and anti-inflammatory effects. Its unique structure and properties allow it to target specific biological pathways and mechanisms, offering new therapeutic options for various diseases.
Used in Organic Chemistry:
5,7-Dimethylpyrazolo[1,5-a]pyrimidin-2-amine is used as a building block for the synthesis of other complex molecules. Its versatile structure and reactivity make it a valuable component in the development of new organic compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1605-78-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,0 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1605-78:
(6*1)+(5*6)+(4*0)+(3*5)+(2*7)+(1*8)=73
73 % 10 = 3
So 1605-78-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N4/c1-5-3-6(2)12-8(10-5)4-7(9)11-12/h3-4H,1-2H3,(H2,9,11)
