16052-12-3 Usage
Uses
Used in Pharmaceutical Synthesis:
2,3-dihydropyridine-2,6-dicarboxylic acid is used as a key intermediate in the synthesis of pharmaceuticals for its ability to form complex molecular structures that can exhibit a range of therapeutic effects.
Used in Organic Compound Preparation:
In the chemical industry, 2,3-dihydropyridine-2,6-dicarboxylic acid serves as a precursor for the preparation of various organic compounds, contributing to the development of new materials and chemical entities.
Used in Cardiovascular Applications:
2,3-dihydropyridine-2,6-dicarboxylic acid is utilized as a calcium channel blocker in cardiovascular medicine, playing a crucial role in the treatment of conditions such as hypertension and angina by regulating the flow of calcium ions into cardiac and vascular smooth muscle cells.
Used in Neurological Applications:
As a potential therapeutic agent for neurological disorders, 2,3-dihydropyridine-2,6-dicarboxylic acid is applied in the development of treatments targeting neurological conditions, potentially modulating neuronal calcium channels to influence neuronal function and alleviate symptoms.
Check Digit Verification of cas no
The CAS Registry Mumber 16052-12-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,0,5 and 2 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 16052-12:
(7*1)+(6*6)+(5*0)+(4*5)+(3*2)+(2*1)+(1*2)=73
73 % 10 = 3
So 16052-12-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h1-2,5H,3H2,(H,9,10)(H,11,12)
