16075-68-6 Usage
Uses
Used in Pharmaceutical Industry:
6-METHYL-2H-PYRIDO[1,2-A]PYRIMIDIN-2-ONE is used as an anticancer agent for its ability to inhibit the enzyme dihydrofolate reductase, which plays a crucial role in DNA and RNA synthesis. This inhibition can lead to the disruption of cancer cell proliferation, making MPP a candidate for the development of cancer therapeutics.
Used in Anticancer Research:
In the field of oncology, 6-METHYL-2H-PYRIDO[1,2-A]PYRIMIDIN-2-ONE is utilized as a research compound to explore its potential in treating various types of cancer. Its mechanism of action involves targeting the dihydrofolate reductase enzyme, which is essential for the growth and survival of cancer cells.
Used in Antimicrobial Applications:
6-METHYL-2H-PYRIDO[1,2-A]PYRIMIDIN-2-ONE is also used as an antiprotozoal and antifungal agent, given its potential to combat various infectious diseases by inhibiting the growth of protozoa and fungi, which are responsible for a range of illnesses.
Used in Drug Development:
In the drug development sector, 6-METHYL-2H-PYRIDO[1,2-A]PYRIMIDIN-2-ONE serves as a lead compound for the creation of new pharmaceuticals. Its unique chemical structure and biological activity make it a valuable starting point for the design of novel therapeutic agents targeting a variety of diseases, including cancer and infectious diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 16075-68-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,0,7 and 5 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 16075-68:
(7*1)+(6*6)+(5*0)+(4*7)+(3*5)+(2*6)+(1*8)=106
106 % 10 = 6
So 16075-68-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O/c1-7-3-2-4-8-10-9(12)5-6-11(7)8/h2-6H,1H3
