160776-87-4 Usage
Uses
Used in Pharmaceutical Industry:
Urea, N-[(5-chloro-2-hydroxyphenyl)phenylmethyl]is used as a building block in the synthesis of organic compounds for pharmaceutical applications. Its chemical structure provides opportunities for modifications to create derivatives with specific properties and functions, making it a valuable compound in the development of new drugs.
Used in Agrochemical Industry:
Urea, N-[(5-chloro-2-hydroxyphenyl)phenylmethyl]is used as a key component in the formulation of agrochemicals. Its properties and structure make it suitable for various applications in this industry, contributing to the development of effective and efficient agricultural products.
Used in Organic Chemistry Research:
Urea, N-[(5-chloro-2-hydroxyphenyl)phenylmethyl]is used as a research compound in organic chemistry. Its unique structure and functional groups make it an interesting subject for studying chemical reactions and exploring new synthetic pathways, further expanding its potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 160776-87-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,0,7,7 and 6 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 160776-87:
(8*1)+(7*6)+(6*0)+(5*7)+(4*7)+(3*6)+(2*8)+(1*7)=154
154 % 10 = 4
So 160776-87-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H13ClN2O2/c15-10-6-7-12(18)11(8-10)13(17-14(16)19)9-4-2-1-3-5-9/h1-8,13,18H,(H3,16,17,19)
