160807-91-0 Usage
General Description
1,3-bis[(4-fluorophenyl)-(4-methylphenyl)methyl]urea is a chemical compound with the molecular formula C23H22F2N2O. It is a urea derivative with two bulky aromatic groups attached to the nitrogen atom. 1,3-bis[(4-fluorophenyl)-(4-methylphenyl)methyl]urea is used in organic chemistry as a building block for the synthesis of various biologically active compounds. It has potential applications in medicinal chemistry and drug discovery due to its structural features and potential pharmacological properties. The presence of fluorine and methyl substituents in the phenyl rings adds to the compound's chemical and biological diversity, making it a valuable compound for research and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 160807-91-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,0,8,0 and 7 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 160807-91:
(8*1)+(7*6)+(6*0)+(5*8)+(4*0)+(3*7)+(2*9)+(1*1)=130
130 % 10 = 0
So 160807-91-0 is a valid CAS Registry Number.
InChI:InChI=1/C29H26F2N2O/c1-19-3-7-21(8-4-19)27(23-11-15-25(30)16-12-23)32-29(34)33-28(22-9-5-20(2)6-10-22)24-13-17-26(31)18-14-24/h3-18,27-28H,1-2H3,(H2,32,33,34)