160841-03-2 Usage
Uses
Used in Pharmaceutical Research:
(2R,3R)-2-AMINO-3-PHENYLMETHOXY-1-BUTANOL is used as a chiral building block for the synthesis of biologically active molecules. Its unique stereochemistry allows for the development of enantiomerically pure compounds, which is essential for ensuring the desired pharmacological activity and minimizing potential side effects.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (2R,3R)-2-AMINO-3-PHENYLMETHOXY-1-BUTANOL is employed as a key intermediate in the design and synthesis of novel drug candidates. Its versatility and ability to be incorporated into complex molecular structures make it a valuable tool for the development of new therapeutic agents with improved efficacy and selectivity.
Used in Drug Development:
(2R,3R)-2-AMINO-3-PHENYLMETHOXY-1-BUTANOL is utilized in drug development to explore its potential pharmacological activities. Researchers are interested in investigating its interactions with various biological targets, such as enzymes, receptors, and ion channels, to identify its therapeutic potential in treating a range of diseases and conditions.
Used in Organic Synthesis:
In organic synthesis, (2R,3R)-2-AMINO-3-PHENYLMETHOXY-1-BUTANOL serves as a versatile starting material for the preparation of a wide array of chiral compounds. Its butanol backbone and phenylmethoxy group can be further modified and functionalized to generate diverse chemical entities with tailored properties and applications.
Overall, (2R,3R)-2-AMINO-3-PHENYLMETHOXY-1-BUTANOL is a promising chemical entity with significant potential in various industries, particularly in the fields of pharmaceutical research, medicinal chemistry, and drug development. Its unique structure, stereochemistry, and functional groups make it an invaluable asset for the synthesis of biologically active molecules and the advancement of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 160841-03-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,0,8,4 and 1 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 160841-03:
(8*1)+(7*6)+(6*0)+(5*8)+(4*4)+(3*1)+(2*0)+(1*3)=112
112 % 10 = 2
So 160841-03-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO2/c1-9(11(12)7-13)14-8-10-5-3-2-4-6-10/h2-6,9,11,13H,7-8,12H2,1H3/t9-,11-/m1/s1