16085-50-0 Usage
Uses
Used in Chemical Synthesis:
1,5-DIMETHYL-1H,5H-[1,2,4]TRIAZOLO[1,2-A][1,2,4]TRIAZOLE-3,7-DITHIOL is utilized as a key intermediate in the synthesis of various organic compounds. Its presence in the molecular structure of target compounds can impart specific reactivity and stability, making it a crucial component in the development of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Research:
As a heterocyclic compound, 1,5-DIMETHYL-1H,5H-[1,2,4]TRIAZOLO[1,2-A][1,2,4]TRIAZOLE-3,7-DITHIOL serves as a valuable subject for research in organic chemistry. Its unique structure allows scientists to explore its reactivity, stability, and potential applications in the synthesis of novel compounds. Additionally, it can be used to study the fundamental principles of chemical reactions involving heterocyclic systems.
Used in Materials Science:
1,5-DIMETHYL-1H,5H-[1,2,4]TRIAZOLO[1,2-A][1,2,4]TRIAZOLE-3,7-DITHIOL is considered a potential building block for the development of new materials. Its incorporation into the molecular structure of materials can lead to the creation of materials with enhanced properties, such as improved thermal stability, electrical conductivity, or mechanical strength. This makes it a promising candidate for applications in various industries, including electronics, aerospace, and automotive.
Check Digit Verification of cas no
The CAS Registry Mumber 16085-50-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,0,8 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 16085-50:
(7*1)+(6*6)+(5*0)+(4*8)+(3*5)+(2*5)+(1*0)=100
100 % 10 = 0
So 16085-50-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N4S2/c1-3-7-5(11)10-4(2)8-6(12)9(3)10/h3-4H,1-2H3,(H,7,11)(H,8,12)
Xi:Irritant;
