16105-69-4 Usage
Property
Different sources of media describe the Property of 16105-69-4 differently. You can refer to the following data:
1. Amino acid derivative with a long hydrocarbon chain
2. Surfactant properties
3. Amphiphilic nature
Use
Different sources of media describe the Use of 16105-69-4 differently. You can refer to the following data:
1. Emulsifying and dispersing agent
2. Emollient in cosmetic and personal care products
3. Thickening agent and stabilizer in cosmetic and personal care products
Potential application
Excipient or drug delivery vehicle in pharmaceuticals
Overall
Diverse uses and valuable chemical in various industries
Check Digit Verification of cas no
The CAS Registry Mumber 16105-69-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,1,0 and 5 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 16105-69:
(7*1)+(6*6)+(5*1)+(4*0)+(3*5)+(2*6)+(1*9)=84
84 % 10 = 4
So 16105-69-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h17,20H,2-16,19H2,1H3/t17-/m0/s1