16106-59-5 Usage
Uses
Used in Chemical Industry:
4,5-DIMETHYL-1-HEXENE is used as a chemical intermediate for the synthesis of various compounds, such as polymers, fragrances, and pharmaceuticals. Its unique molecular structure allows it to be a versatile building block in the creation of a wide range of products.
Used in Polymer Industry:
4,5-DIMETHYL-1-HEXENE is used as a monomer in the production of polymers. Its incorporation into polymer chains can enhance the material's properties, such as flexibility, strength, and durability, making it suitable for various applications, including automotive, packaging, and consumer goods.
Used in Fragrance Industry:
4,5-DIMETHYL-1-HEXENE is used as a component in the formulation of fragrances and perfumes. Its distinct chemical structure contributes to the overall scent profile, providing a unique and pleasant aroma.
Used in Pharmaceutical Industry:
4,5-DIMETHYL-1-HEXENE can be used as a starting material for the synthesis of various pharmaceutical compounds. Its chemical properties make it a valuable precursor in the development of new drugs and medications.
Check Digit Verification of cas no
The CAS Registry Mumber 16106-59-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,1,0 and 6 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 16106-59:
(7*1)+(6*6)+(5*1)+(4*0)+(3*6)+(2*5)+(1*9)=85
85 % 10 = 5
So 16106-59-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H16/c1-5-6-8(4)7(2)3/h5,7-8H,1,6H2,2-4H3
