161178-07-0 Usage
General Description
"(2S)-2-[(7-fluoro-2,3-dihydro-1H-inden-4-yl)oxymethyl]morpholine" is a chemical compound with a complex structure. It contains a morpholine ring, which is a heterocyclic amine, and a 7-fluoro-2,3-dihydro-1H-inden-4-yl group. The 2S configuration indicates the stereochemistry of the compound. This chemical may have potential applications in pharmaceuticals or agrochemicals due to its unique structure and the presence of the morpholine and indene moieties, which are common in bioactive compounds. However, further research is needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 161178-07-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,1,1,7 and 8 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 161178-07:
(8*1)+(7*6)+(6*1)+(5*1)+(4*7)+(3*8)+(2*0)+(1*7)=120
120 % 10 = 0
So 161178-07-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H18FNO2/c15-13-4-5-14(12-3-1-2-11(12)13)18-9-10-8-16-6-7-17-10/h4-5,10,16H,1-3,6-9H2/t10-/m0/s1
161178-07-0Relevant articles and documents
Morpholine derivative
-
, (2008/06/13)
A morpholine derivative represented by formula (I) or a pharmaceutically acceptable salt thereof: STR1 wherein R1 and R3, which may be the same or different, each represent a hydrogen atom or a lower alkyl group; R2 repres