161344-85-0 Usage
Uses
Used in Pharmaceutical Synthesis:
2-BUTYL-[1,3,2]DIOXABOROLANE-4,5-DICARBOXYLIC ACID BIS-DIMETHYLAMIDE is used as a cyclopropanation ligand for the total synthesis of natural products and pharmaceutical compounds. Its unique structure allows it to participate in key reactions, facilitating the formation of complex molecular architectures.
Used in Marine Natural Products Synthesis:
In the field of marine natural products, 2-BUTYL-[1,3,2]DIOXABOROLANE-4,5-DICARBOXYLIC ACID BIS-DIMETHYLAMIDE is used as a cyclopropanation ligand for the synthesis of (+)-Frondosin, a natural product derived from marine sponges. 2-BUTYL-[1,3,2]DIOXABOROLANE-4,5-DICARBOXYLIC ACID BIS-DIMETHYLAMIDE has shown potential biological activities, making it an important target for pharmaceutical research.
Used in Cyanobacterium Natural Products Synthesis:
2-BUTYL-[1,3,2]DIOXABOROLANE-4,5-DICARBOXYLIC ACID BIS-DIMETHYLAMIDE is also used in the synthesis of coibacins A and B, which are natural products derived from marine cyanobacteria. These compounds have demonstrated various biological properties, making them valuable for the development of new drugs and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 161344-85-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,1,3,4 and 4 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 161344-85:
(8*1)+(7*6)+(6*1)+(5*3)+(4*4)+(3*4)+(2*8)+(1*5)=120
120 % 10 = 0
So 161344-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H23BN2O4/c1-6-7-8-13-18-9(11(16)14(2)3)10(19-13)12(17)15(4)5/h9-10H,6-8H2,1-5H3/t9-,10-/m1/s1
