161512-71-6 Usage
General Description
N-Acetyl-S-benzyl-D-cysteine is a chemical compound which is a derivative of the amino acid cysteine. In this compound, the sulfur atom in cysteine is bonded to a benzyl group and the amine group is acetylated. This modification generally increases the durability and stability of the molecule. It plays an important role in chemical and pharmaceutical research as it is used as a precursor in the synthesis of various functional molecules. Its stereochemistry, molecular structure and reactivity allow it to participate in diverse chemical reactions essential for the development of many pharmaceutical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 161512-71-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,1,5,1 and 2 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 161512-71:
(8*1)+(7*6)+(6*1)+(5*5)+(4*1)+(3*2)+(2*7)+(1*1)=106
106 % 10 = 6
So 161512-71-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO3S/c1-9(14)13-11(12(15)16)8-17-7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3,(H,13,14)(H,15,16)/t11-/m1/s1
