161661-17-2 Usage
Uses
Used in Medicinal Chemistry:
(R)-8-BROMO-2-AMINOTETRALIN is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Drug Development:
(R)-8-BROMO-2-AMINOTETRALIN is used as a lead compound in drug discovery and development. Its structural features and potential pharmacological properties make it a valuable starting point for designing new drugs with improved efficacy and safety profiles.
Used in Research and Testing:
(R)-8-BROMO-2-AMINOTETRALIN is used as a research tool to study its biological activities and potential therapeutic applications. Further research is needed to understand its mechanism of action, pharmacokinetics, and pharmacodynamics, as well as to evaluate its safety and efficacy in various disease models.
Note: The specific applications and industries for (R)-8-BROMO-2-AMINOTETRALIN are not provided in the given materials. The uses mentioned above are based on the general potential of (R)-8-BROMO-2-AMINOTETRALIN in the field of medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 161661-17-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,1,6,6 and 1 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 161661-17:
(8*1)+(7*6)+(6*1)+(5*6)+(4*6)+(3*1)+(2*1)+(1*7)=122
122 % 10 = 2
So 161661-17-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12BrN/c11-10-3-1-2-7-4-5-8(12)6-9(7)10/h1-3,8H,4-6,12H2
