16223-25-9 Usage
Uses
Used in Pharmaceutical Industry:
ETHYL-1,2,4-OXADIAZOLE-3-CARBOXYLATE is used as a ligand for metal ion complexes, which can enhance the properties of these complexes for various pharmaceutical applications. Its ability to chelate metal ions can improve the stability, solubility, and biological activity of the resulting complexes.
Used in Organic Synthesis:
In the field of organic synthesis, ETHYL-1,2,4-OXADIAZOLE-3-CARBOXYLATE serves as a precursor for the synthesis of other organic compounds. Its unique structure allows for the creation of a variety of molecules with potential applications in different industries.
Used in Material Development:
ETHYL-1,2,4-OXADIAZOLE-3-CARBOXYLATE is utilized in the development of new materials due to its chemical properties. Its incorporation into materials can lead to novel properties that may be beneficial in various applications, such as improved stability or specific reactivity.
Used in Medicinal Chemistry Research:
ETHYL-1,2,4-OXADIAZOLE-3-CARBOXYLATE is also used in medicinal chemistry research for the exploration of its potential biological activities. Studies on ETHYL-1,2,4-OXADIAZOLE-3-CARBOXYLATE may lead to the discovery of new therapeutic agents or contribute to a better understanding of molecular interactions in biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 16223-25-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,2,2 and 3 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 16223-25:
(7*1)+(6*6)+(5*2)+(4*2)+(3*3)+(2*2)+(1*5)=79
79 % 10 = 9
So 16223-25-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H16N2O/c16-13-9-10-3-1-2-4-12(10)15(13)11-5-7-14-8-6-11/h1-4,11,14H,5-9H2
16223-25-9Relevant academic research and scientific papers
A short and efficient synthesis of N-substituted indol-2-ones (oxindoles)
Forbes, Ian T
, p. 6943 - 6945 (2007/10/03)
A short and high yielding process has been developed for the synthesis of N-(4-piperidinyl)-indol-2-ones. This strategy also constitutes a general route to N-substituted indol-2-ones.
