16239-84-2 Usage
Structure
Thiazole derivative containing an amino group and a nitrofuryl group
Biological Activities
Antimicrobial and anticancer properties
Application
Commonly used in pharmaceutical research and drug development
Versatility
Unique structure and functional groups make it a versatile building block for synthesis
Value
Valuable compound in medicinal chemistry and pharmaceutical research
Check Digit Verification of cas no
The CAS Registry Mumber 16239-84-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,2,3 and 9 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 16239-84:
(7*1)+(6*6)+(5*2)+(4*3)+(3*9)+(2*8)+(1*4)=112
112 % 10 = 2
So 16239-84-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7N3O3S/c10-9-11-6(5-16-9)1-2-7-3-4-8(15-7)12(13)14/h1-5H,(H2,10,11)/b2-1+
