16251-00-6 Usage
General Description
1,4-Bis(ethoxy)tetrafluorobenzene is a chemical compound that falls under the category of organic compounds known as benzene and substituted derivatives. These compounds contain a monocyclic ring system consisting of six carbon atoms. In the case of 1,4-Bis(ethoxy)tetrafluorobenzene, two of these carbon atoms are bonded to ethoxy groups, and four of them are bonded to fluorine atoms. This chemical is generally used in the field of industrial chemistry due to its properties, including its stability and reactivity. Additionally, it also plays a significant role in various research studies due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 16251-00-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,2,5 and 1 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 16251-00:
(7*1)+(6*6)+(5*2)+(4*5)+(3*1)+(2*0)+(1*0)=76
76 % 10 = 6
So 16251-00-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H10F4O2/c1-3-15-9-5(11)7(13)10(16-4-2)8(14)6(9)12/h3-4H2,1-2H3
