16257-71-9 Usage
Uses
Used in Pharmaceutical Industry:
(2S,4R)-4-bromopyrrolidine-2-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique reactivity, stemming from the bromine atom and carboxylic acid group, allows for the creation of novel drug molecules with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, (2S,4R)-4-bromopyrrolidine-2-carboxylic acid serves as a versatile building block. Its stereochemistry and functional groups enable the formation of diverse chemical structures, facilitating the development of new organic compounds with specific properties and applications.
Used in Drug Discovery:
(2S,4R)-4-bromopyrrolidine-2-carboxylic acid is utilized in drug discovery processes to identify and optimize potential drug candidates. Its unique properties and reactivity contribute to the design and synthesis of new molecules with therapeutic potential, advancing the development of innovative treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 16257-71-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,2,5 and 7 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 16257-71:
(7*1)+(6*6)+(5*2)+(4*5)+(3*7)+(2*7)+(1*1)=109
109 % 10 = 9
So 16257-71-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H8BrNO2/c6-3-1-4(5(8)9)7-2-3/h3-4,7H,1-2H2,(H,8,9)/t3-,4+/m1/s1
