16257-89-9 Usage
Uses
Used in Pharmaceutical Development:
(2S,4R)-4-aminopyrrolidine-2-carboxylic acid dihydrochloride is used as a key intermediate in the development of pharmaceuticals for its potential role in the synthesis of bioactive compounds and drug candidates. Its specific stereochemistry and reactivity contribute to the creation of new medicines with targeted therapeutic effects.
Used in Organic Synthesis:
In the field of organic synthesis, (2S,4R)-4-aminopyrrolidine-2-carboxylic acid dihydrochloride is utilized as a building block for the assembly of complex organic molecules. Its properties allow it to participate in a wide range of chemical reactions, making it a valuable component in the synthesis of various organic compounds.
Used in Research Laboratories:
(2S,4R)-4-aminopyrrolidine-2-carboxylic acid dihydrochloride is employed as a research chemical in academic and industrial laboratories. Its enhanced solubility and stability in the dihydrochloride salt form make it an ideal candidate for experiments and studies aimed at understanding its chemical behavior and potential applications in various chemical and biological processes.
Used in Drug Discovery:
(2S,4R)-4-aminopyrrolidine-2-carboxylic acid dihydrochloride is used as a starting material in drug discovery for its potential to be incorporated into novel drug molecules. Its unique structural features and reactivity make it a promising candidate for the development of new therapeutic agents with specific pharmacological properties.
Used in Chemical Reactions:
In the realm of chemical reactions, (2S,4R)-4-aminopyrrolidine-2-carboxylic acid dihydrochloride is used as a reactant to facilitate the formation of desired products. Its participation in various types of reactions, such as condensation, substitution, and rearrangement, highlights its utility in achieving specific synthetic goals.
Used in the Synthesis of Complex Organic Molecules:
(2S,4R)-4-aminopyrrolidine-2-carboxylic acid dihydrochloride is utilized in the synthesis of complex organic molecules, where its specific stereochemistry and reactivity play a crucial role in achieving the desired molecular structures. This application is particularly relevant in the development of advanced materials, specialty chemicals, and other high-value organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 16257-89-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,2,5 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 16257-89:
(7*1)+(6*6)+(5*2)+(4*5)+(3*7)+(2*8)+(1*9)=119
119 % 10 = 9
So 16257-89-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2O2.2ClH/c6-3-1-4(5(8)9)7-2-3;;/h3-4,7H,1-2,6H2,(H,8,9);2*1H/t3-,4+;;/m1../s1
