16263-37-9 Usage
General Description
Potassium phenylphosphinate is a chemical compound that consists of potassium and phenylphosphinate, with the chemical formula C6H5O2P. It is often used as a flame retardant in various materials, including plastics and textiles, due to its ability to inhibit the combustion process. When exposed to high temperatures, potassium phenylphosphinate releases phosphorus-containing radicals that interfere with the combustion process and limit the spread of flames. This makes it an important component in fire safety applications, where it helps to reduce the flammability of materials and prevent the rapid spread of fires. Additionally, it has potential applications in the synthesis of organic compounds and as a reagent in chemical reactions due to its phosphorus-containing nature.
Check Digit Verification of cas no
The CAS Registry Mumber 16263-37-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,2,6 and 3 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 16263-37:
(7*1)+(6*6)+(5*2)+(4*6)+(3*3)+(2*3)+(1*7)=99
99 % 10 = 9
So 16263-37-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H7O2P.K/c7-9(8)6-4-2-1-3-5-6;/h1-5,9H,(H,7,8);/q;+1/p-1
