16263-37-9 Usage
Uses
Used in Flame Retardant Applications:
Potassium phenylphosphinate is used as a flame retardant in various materials, such as plastics and textiles, for its ability to inhibit the combustion process. When exposed to high temperatures, it releases phosphorus-containing radicals that interfere with the combustion process and limit the spread of flames, thereby reducing the flammability of materials and preventing the rapid spread of fires.
Used in Chemical Synthesis:
Potassium phenylphosphinate has potential applications in the synthesis of organic compounds due to its phosphorus-containing nature. It can be used as a reagent in chemical reactions, contributing to the development of new compounds and materials.
Used in Fire Safety Industry:
In the fire safety industry, potassium phenylphosphinate is used as a crucial component in the development of fire-resistant materials. Its flame retardant properties help in enhancing the safety of various products and structures, reducing the risk of fire-related accidents and damage.
Check Digit Verification of cas no
The CAS Registry Mumber 16263-37-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,2,6 and 3 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 16263-37:
(7*1)+(6*6)+(5*2)+(4*6)+(3*3)+(2*3)+(1*7)=99
99 % 10 = 9
So 16263-37-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H7O2P.K/c7-9(8)6-4-2-1-3-5-6;/h1-5,9H,(H,7,8);/q;+1/p-1
