163045-78-1 Usage
General Description
Thiophene, 3-cyclohexyl-4-methyl-, also known as 3-cyclohexyl-4-methylthiophene, is a chemical compound with the molecular formula C12H16S. It is a heterocyclic compound with a five-membered ring containing one sulfur atom and is commonly used in the synthesis of various organic compounds. Thiophene derivatives are known for their diverse range of applications, including pharmaceuticals, agrochemicals, and materials science. The 3-cyclohexyl-4-methylthiophene compound is often utilized in the creation of novel organic compounds with potential uses in pharmaceuticals, polymers, and other industries. Additionally, it has properties that make it suitable for various research and development purposes in chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 163045-78-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,3,0,4 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 163045-78:
(8*1)+(7*6)+(6*3)+(5*0)+(4*4)+(3*5)+(2*7)+(1*8)=121
121 % 10 = 1
So 163045-78-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H16S/c1-9-7-12-8-11(9)10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3