16347-94-7 Usage
Explanation
Different sources of media describe the Explanation of 16347-94-7 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule of 1-Butylquinazolin-4(1H)-one.
2. 1-Butylquinazolin-4(1H)-one is a derivative of quinazolin-4(1H)-one, which is a part of the quinazolinone family of compounds.
3. A heterocyclic compound is a cyclic compound that contains atoms of different elements, such as carbon, nitrogen, and oxygen, in its ring structure.
4. The "1-butyl" portion of the name indicates the presence of a butyl group, which is an alkyl group with four carbon atoms (C4H9) attached to the compound.
5. 1-Butylquinazolin-4(1H)-one may have applications in the field of medicinal chemistry due to its quinazolin-4(1H)-one derivative nature.
6. Quinazolin-4(1H)-one derivatives, including 1-Butylquinazolin-4(1H)-one, have been investigated for their potential pharmaceutical properties, such as acting as anti-inflammatory and anti-cancer agents.
Quinazolin-4(1H)-one derivative
Member of the quinazolinone family
Heterocyclic compound
Contains at least two different elements in its ring structure
1-Butyl
Presence of a butyl group
Potential applications
Medicinal chemistry
Pharmaceutical properties
Anti-inflammatory and anti-cancer agents
Check Digit Verification of cas no
The CAS Registry Mumber 16347-94-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,3,4 and 7 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 16347-94:
(7*1)+(6*6)+(5*3)+(4*4)+(3*7)+(2*9)+(1*4)=117
117 % 10 = 7
So 16347-94-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H14N2O/c1-2-3-8-14-9-13-12(15)10-6-4-5-7-11(10)14/h4-7,9H,2-3,8H2,1H3
