163733-98-0 Usage
Uses
Used in Pharmaceutical Industry:
Phenol, 2-amino-3,5-difluoro(9CI) is used as a key intermediate in the production of various pharmaceuticals. Its unique structure and fluorine atoms contribute to the development of new drugs with improved pharmacological properties and therapeutic effects.
Used in Agrochemical Industry:
In the agrochemical industry, Phenol, 2-amino-3,5-difluoro(9CI) is utilized as a building block for the synthesis of agrochemicals. Its potential biological activities make it a promising candidate for the development of new pesticides, herbicides, and other agrochemical products.
Used in Dye Industry:
Phenol, 2-amino-3,5-difluoro(9CI) is also used in the dye industry for the production of various dyes. Its unique structure and properties allow for the creation of dyes with specific characteristics, such as color intensity, stability, and solubility.
Used in Medicinal Chemistry Research:
Phenol, 2-amino-3,5-difluoro(9CI) is of interest in the field of medicinal chemistry due to its potential biological activities and pharmacological properties. Researchers are exploring its applications in drug discovery and development, aiming to harness its unique characteristics for the creation of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 163733-98-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,3,7,3 and 3 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 163733-98:
(8*1)+(7*6)+(6*3)+(5*7)+(4*3)+(3*3)+(2*9)+(1*8)=150
150 % 10 = 0
So 163733-98-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H5F2NO/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H,9H2
