163734-01-8 Usage
Uses
Used in Research and Laboratory Applications:
Phenol, 2-amino-4,5-difluoro(9CI) is used as a building block in the synthesis of complex organic compounds for various research purposes. Its unique structure allows for the creation of novel molecules with potential applications in different fields.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Phenol, 2-amino-4,5-difluoro(9CI) is used as a precursor or intermediate in the development of new drugs. Its specific chemical properties may contribute to the design of innovative therapeutic agents.
Used in Agrochemical Industry:
Phenol, 2-amino-4,5-difluoro(9CI) may also find applications in the agrochemical industry, potentially serving as a component in the formulation of new pesticides or other agricultural chemicals. Its unique structure could provide advantages in terms of effectiveness or selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 163734-01-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,3,7,3 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 163734-01:
(8*1)+(7*6)+(6*3)+(5*7)+(4*3)+(3*4)+(2*0)+(1*1)=128
128 % 10 = 8
So 163734-01-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H5F2NO/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H,9H2
