1638-60-4 Usage
General Description
DL-Alanyl-L-Leucine is a type of dipeptide composed of the amino acids Alanine and Leucine. It is often used in research settings, particularly in the field of biochemistry. Dipeptides like DL-Alanyl-L-Leucine can have a wide range of potential biological activities, including anti-aging, anti-oxidant, and anti-inflammatory effects. They have attracted attention in pharmaceutical research and development due to these potential health benefits. As a laboratory-grade reagent, DL-Alanyl-L-Leucine is typically used in the synthesis of other chemical compounds, or in the investigation of biological processes or pathways. Its specific properties can vary depending on the way it is synthesized.
Check Digit Verification of cas no
The CAS Registry Mumber 1638-60-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,3 and 8 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1638-60:
(6*1)+(5*6)+(4*3)+(3*8)+(2*6)+(1*0)=84
84 % 10 = 4
So 1638-60-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H18N2O3/c1-5(2)4-7(9(13)14)11-8(12)6(3)10/h5-7H,4,10H2,1-3H3,(H,11,12)(H,13,14)/t6?,7-/m0/s1