1638-95-5 Usage
Explanation
Different sources of media describe the Explanation of 1638-95-5 differently. You can refer to the following data:
1. 1-Methylcyclopentanethiol is a chemical compound composed of carbon (C), hydrogen (H), and sulfur (S) atoms, with a specific arrangement of 6 carbon, 12 hydrogen, and 1 sulfur atom.
2. In its pure form, 1-Methylcyclopentanethiol appears as a colorless liquid, which means it does not have any color and flows like other liquids.
3. Strong, unpleasant odor
3. 1-Methylcyclopentanethiol has a potent and offensive smell, making it distinct and easily recognizable.
4. This chemical compound is also referred to as methylandrostanolone, which is an alternative name used in scientific literature and industry.
5. Due to its powerful smell, 1-Methylcyclopentanethiol is used in the production of fragrances and flavorings, adding a sulfurous, meaty note to the final product.
6. Applications in perfumes, colognes, and food flavorings
6. The strong odor of 1-Methylcyclopentanethiol is utilized in various consumer products, such as perfumes, colognes, and food flavorings, to provide unique and intense scents.
7. Precursor in organic synthesis
7. 1-Methylcyclopentanethiol serves as a starting material or intermediate in the synthesis of other organic compounds, making it a valuable chemical building block.
8. Industrial uses in rubber and plastics production
8. This chemical compound is also employed in the manufacturing of rubber and plastic products, showcasing its versatility in various industries.
Physical state
Colorless liquid
Use in fragrances and flavorings
Strong odor addition
Check Digit Verification of cas no
The CAS Registry Mumber 1638-95-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,3 and 8 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1638-95:
(6*1)+(5*6)+(4*3)+(3*8)+(2*9)+(1*5)=95
95 % 10 = 5
So 1638-95-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H12S/c1-6(7)4-2-3-5-6/h7H,2-5H2,1H3
