16388-74-2 Usage
Chemical structure
A complex molecule consisting of an anthraquinone core with an amino group, an anilino group, and a thioether group attached.
Intense color properties
Used in the manufacturing of a wide range of dyes and pigments due to its vibrant color.
Oxidation-reduction reactions
Ability to undergo oxidation-reduction reactions, which is useful in various chemical processes.
Metal complexation
Forms stable complexes with metal ions, making it useful in the formulation of metal chelating agents.
Photodynamic therapy
Studied for potential applications in photodynamic therapy for cancer treatment, as it can generate reactive oxygen species when exposed to light.
Reactive oxygen species generation
Can induce cell death in cancerous tissues by generating reactive oxygen species upon light exposure.
Versatility
Important chemical in the fields of dye chemistry, metal complexation, and medical research.
Applications
Used in various industries, including textile, pharmaceutical, and chemical manufacturing.
Check Digit Verification of cas no
The CAS Registry Mumber 16388-74-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,3,8 and 8 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 16388-74:
(7*1)+(6*6)+(5*3)+(4*8)+(3*8)+(2*7)+(1*4)=132
132 % 10 = 2
So 16388-74-2 is a valid CAS Registry Number.
InChI:InChI=1/C24H23N3O2S/c1-27(2)12-13-30-19-14-18(26-15-8-4-3-5-9-15)20-21(22(19)25)24(29)17-11-7-6-10-16(17)23(20)28/h3-11,14,26H,12-13,25H2,1-2H3