164323-85-7 Usage
Uses
Used in Chemical Research:
(R)-Methyl nipecotate is used as a chiral building block for the synthesis of various organic compounds. Its unique structure and the presence of a chiral center make it a valuable component in the development of enantioselective reactions and the creation of new chiral molecules.
Used in Pharmaceutical Research:
(R)-Methyl nipecotate is employed as an intermediate in the synthesis of pharmaceutical compounds. Its chiral nature allows for the development of enantiomerically pure drugs, which can exhibit different biological activities and reduce potential side effects associated with racemic mixtures.
Used in Asymmetric Catalysis:
(R)-Methyl nipecotate is utilized as a ligand or catalyst in asymmetric catalysis, a technique that enables the selective formation of one enantiomer over the other. This is crucial in the production of enantiomerically pure compounds, which are often required for pharmaceutical applications.
Used in Analytical Chemistry:
(R)-Methyl nipecotate can be used as a chiral reference standard in analytical chemistry. Its distinct enantiomers can be used to calibrate instruments and develop methods for the separation and identification of chiral compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 164323-85-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,4,3,2 and 3 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 164323-85:
(8*1)+(7*6)+(6*4)+(5*3)+(4*2)+(3*3)+(2*8)+(1*5)=127
127 % 10 = 7
So 164323-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H13NO2/c1-10-7(9)6-3-2-4-8-5-6/h6,8H,2-5H2,1H3/t6-/m1/s1
