164329-39-9 Usage
General Description
2-(2-ethoxyacetyl)-1,8-dimethylimidazo[1,2-a]quinoxalin-4(5H)-one, also known as EDAI, is a chemical compound with potential pharmaceutical and biological applications. It is a heterocyclic compound that contains an imidazoquinoxaline ring system. EDAI has been studied for its potential anticancer properties and has shown to inhibit the growth of certain cancer cell lines. It has also been studied for its potential anti-inflammatory and anti-microbial properties. The ethoxyacetyl group on the molecule may contribute to its ability to cross cellular membranes, making it a potentially useful drug candidate for various medical applications. Further research is needed to fully understand and harness the potential of EDAI and its derivatives.
Check Digit Verification of cas no
The CAS Registry Mumber 164329-39-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,4,3,2 and 9 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 164329-39:
(8*1)+(7*6)+(6*4)+(5*3)+(4*2)+(3*9)+(2*3)+(1*9)=139
139 % 10 = 9
So 164329-39-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H17N3O3/c1-4-22-8-13(20)14-10(3)19-12-7-9(2)5-6-11(12)17-16(21)15(19)18-14/h5-7H,4,8H2,1-3H3,(H,17,21)