16490-14-5 Usage
Uses
Used in Pharmaceutical Industry:
4-Pyrimidinecarboxylic acid, 2,6-diamino(6CI,8CI,9CI) is used as a building block in the synthesis of various drugs and pharmaceuticals. Its unique chemical structure allows it to be incorporated into the development of new medications, potentially leading to the discovery of novel therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical industry, 4-Pyrimidinecarboxylic acid, 2,6-diamino(6CI,8CI,9CI) may have potential uses in the production of agrochemicals. Its chemical properties can be utilized to create compounds that can enhance crop protection and improve agricultural productivity.
Used in Dye Industry:
4-Pyrimidinecarboxylic acid, 2,6-diamino(6CI,8CI,9CI) is also used in the dye industry for the production of various dyes and pigments. Its ability to form different chemical structures makes it a valuable component in creating a wide range of colorants for various applications.
Used in Research and Development:
As a research tool and reagent, 4-Pyrimidinecarboxylic acid, 2,6-diamino(6CI,8CI,9CI) plays a crucial role in biochemistry and organic chemistry. It aids scientists in understanding the fundamental principles of chemical reactions and contributes to the advancement of scientific knowledge in these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 16490-14-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,4,9 and 0 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 16490-14:
(7*1)+(6*6)+(5*4)+(4*9)+(3*0)+(2*1)+(1*4)=105
105 % 10 = 5
So 16490-14-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N4O2/c6-3-1-2(4(10)11)8-5(7)9-3/h1H,(H,10,11)(H4,6,7,8,9)
16490-14-5Relevant academic research and scientific papers
Mapping the landscape of potentially primordial informational oligomers: Oligo-dipeptides tagged with orotic acid derivatives as recognition elements
Zhang, Xuejun,Krishnamurthy, Ramanarayanan
supporting information; scheme or table, p. 8124 - 8128 (2010/03/01)
Partner up! Base-pairing properties of oligo-dipeptides tagged with orotic acid and its 2,4- diamino counterpart (see structure) are found to be consistent with previously observed correlations between ΔpKa values and the pairing strength of co
