16496-38-1 Usage
Uses
Used in Organic Synthesis:
Dimethyl tetrahydro-5-oxofuran-2,3-dicarboxylate is utilized as an intermediate in organic synthesis for its ability to facilitate the creation of complex organic molecules. Its unique structure allows for versatile reactions, making it a valuable component in the synthesis of a wide range of compounds.
Used in Pharmaceutical Production:
In the pharmaceutical industry, dimethyl tetrahydro-5-oxofuran-2,3-dicarboxylate is employed as a building block for the development of new drugs. Its incorporation into drug molecules can enhance their efficacy and selectivity, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Development:
dimethyl tetrahydro-5-oxofuran-2,3-dicarboxylate also finds application in the agrochemical sector, where it is used in the synthesis of various agrochemicals. Its role in creating effective and targeted agrochemicals is crucial for agricultural productivity and pest control.
Used in Research for Biological Activities:
Dimethyl tetrahydro-5-oxofuran-2,3-dicarboxylate is investigated for its potential biological activities, such as anti-inflammatory and anti-tumor properties. This research is significant for identifying new therapeutic agents and understanding the compound's impact on biological systems.
Overall, dimethyl tetrahydro-5-oxofuran-2,3-dicarboxylate's diverse applications across different industries underscore its importance as a versatile and valuable chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 16496-38-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,4,9 and 6 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 16496-38:
(7*1)+(6*6)+(5*4)+(4*9)+(3*6)+(2*3)+(1*8)=131
131 % 10 = 1
So 16496-38-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H10O6/c1-12-7(10)4-3-5(9)14-6(4)8(11)13-2/h4,6H,3H2,1-2H3
