16510-14-8 Usage
General Description
2,5-Dihydroxybenzoic acid, compound with N4-(7-chloro-4-quinolyl)-N1,N1-diethylpentane-1,4-diamine, is a chemical complex formed by the combination of two substances. 2,5-Dihydroxybenzoic acid, also known as gentisic acid, is a naturally occurring compound with antioxidant and anti-inflammatory properties. N4-(7-chloro-4-quinolyl)-N1,N1-diethylpentane-1,4-diamine, on the other hand, is a synthetic compound commonly used as an antimalarial medication. The combination of these two substances may have potential applications in the pharmaceutical industry for the development of new drugs with enhanced therapeutic properties. Further research is needed to understand the specific effects and potential benefits of this chemical complex.
Check Digit Verification of cas no
The CAS Registry Mumber 16510-14-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,5,1 and 0 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 16510-14:
(7*1)+(6*6)+(5*5)+(4*1)+(3*0)+(2*1)+(1*4)=78
78 % 10 = 8
So 16510-14-8 is a valid CAS Registry Number.
