16583-13-4 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-3,4,5,6-tetrafluorotoluene is used as a key intermediate for the synthesis of new pharmaceuticals. Its unique structure and reactivity allow for the creation of novel drug candidates with potential therapeutic applications in various medical fields.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Bromo-3,4,5,6-tetrafluorotoluene is utilized as a building block in the development of innovative agrochemicals. Its properties enable the production of new compounds with improved pesticidal or herbicidal activities, contributing to more effective and sustainable agricultural practices.
Used in Industrial Chemical Production:
2-Bromo-3,4,5,6-tetrafluorotoluene also finds application in the production of various industrial chemicals. Its versatility and reactivity make it a valuable component in the synthesis of specialty chemicals used across different industries, such as plastics, coatings, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 16583-13-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,5,8 and 3 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 16583-13:
(7*1)+(6*6)+(5*5)+(4*8)+(3*3)+(2*1)+(1*3)=114
114 % 10 = 4
So 16583-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H3BrF4/c1-2-3(8)5(10)7(12)6(11)4(2)9/h1H3
