16586-43-9 Usage
General Description
3-[[4-[(2-chloro-4-nitrophenyl)azo]-3-methylphenyl]ethylamino]propiononitrile is a chemical compound with a complex structure, consisting of a propiononitrile group connected to an ethylamino group, which in turn is attached to a 3-methylphenyl group that contains a 2-chloro-4-nitrophenylazo moiety. 3-[[4-[(2-chloro-4-nitrophenyl)azo]-3-methylphenyl]ethylamino]propiononitrile is a member of the azo compound family, which are known for their vibrant colors and are widely used as dyes in various industries. However, the specific properties and uses of 3-[[4-[(2-chloro-4-nitrophenyl)azo]-3-methylphenyl]ethylamino]propiononitrile are not readily available, as it may be a relatively rare or experimental compound. Due to the presence of a nitro group, this compound may have potential applications in organic synthesis, pharmaceuticals, or materials science. However, further research and analysis would be necessary to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 16586-43-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,5,8 and 6 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 16586-43:
(7*1)+(6*6)+(5*5)+(4*8)+(3*6)+(2*4)+(1*3)=129
129 % 10 = 9
So 16586-43-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H18ClN5O2/c1-3-23(10-4-9-20)14-5-7-17(13(2)11-14)21-22-18-8-6-15(24(25)26)12-16(18)19/h5-8,11-12H,3-4,10H2,1-2H3