166176-46-1 Usage
Uses
Used in Pharmaceutical Industry:
Imidazo[1,2-b]pyridazin-3-ylamine is used as a key building block for the synthesis of various pharmaceutical compounds, including potential anticancer and antiviral agents. Its unique chemical structure allows for the development of novel therapeutic agents with improved efficacy and selectivity.
Used in Anticancer Applications:
Imidazo[1,2-b]pyridazin-3-ylamine is being investigated for its potential as a kinase inhibitor, which plays a crucial role in regulating cell growth and division. Its ability to target specific kinases involved in cancer cell proliferation and survival has shown promising activity in preclinical studies, making it a potential candidate for the development of targeted cancer therapies.
Used in Antiviral Applications:
Imidazo[1,2-b]pyridazin-3-ylamine is also being explored for its potential antiviral properties. Its unique chemical structure allows it to interact with viral proteins or enzymes, potentially inhibiting viral replication and reducing the severity of viral infections.
Used in Central Nervous System Disorders:
Imidazo[1,2-b]pyridazin-3-ylamine has been studied for its potential use in the treatment of central nervous system disorders. Its ability to modulate specific signaling pathways or target receptors involved in neurological conditions makes it an important target for drug discovery and development research in this area.
Check Digit Verification of cas no
The CAS Registry Mumber 166176-46-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,6,1,7 and 6 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 166176-46:
(8*1)+(7*6)+(6*6)+(5*1)+(4*7)+(3*6)+(2*4)+(1*6)=151
151 % 10 = 1
So 166176-46-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c7-5-4-8-6-2-1-3-9-10(5)6/h1-4H,7H2
