16624-68-3 Usage
Uses
Used in Pharmaceutical Synthesis:
(2R)-2-(Acetylamino)-4-methylpentanamide is used as a starting material for the synthesis of various pharmaceuticals. Its unique structure and reactivity make it a valuable component in the development of new drugs.
Used in Drug Discovery Research:
In the field of drug discovery, (2R)-2-(Acetylamino)-4-methylpentanamide is utilized for its potential to modulate biological processes. This property allows researchers to explore its use in creating new therapeutic agents and understanding its interactions with biological systems.
Used in Organic Chemistry:
(2R)-2-(Acetylamino)-4-methylpentanamide also holds significance in organic chemistry, where it can be employed in various chemical reactions and as a building block for more complex organic compounds. Its chiral nature adds an extra dimension to its utility, as different stereoisomers can exhibit distinct chemical behaviors and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 16624-68-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,6,2 and 4 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 16624-68:
(7*1)+(6*6)+(5*6)+(4*2)+(3*4)+(2*6)+(1*8)=113
113 % 10 = 3
So 16624-68-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N2O2/c1-5(2)4-7(8(9)12)10-6(3)11/h5,7H,4H2,1-3H3,(H2,9,12)(H,10,11)/t7-/m1/s1
