16639-91-1 Usage
Uses
Used in Peptide Synthesis:
N(ALPHA)-ETHOXYCARBONYL-L-ASPARAGINE is used as a protecting group for the carboxyl group of asparagine in peptide synthesis. This allows for selective modification of other amino acid residues in the peptide chain, facilitating the synthesis of complex peptide structures.
Used in Pharmaceutical and Biologically Active Compounds Synthesis:
N(ALPHA)-ETHOXYCARBONYL-L-ASPARAGINE is used as a precursor in the synthesis of various pharmaceutical and biologically active compounds. Its ethoxycarbonyl group serves as a temporary protective group during chemical reactions, which can be removed later to reveal the unaltered asparagine residue, ensuring the successful synthesis of the desired compounds.
Used in Scientific Research:
N(ALPHA)-ETHOXYCARBONYL-L-ASPARAGINE is employed in scientific research for the synthesis of peptides and other organic molecules, contributing to the advancement of various scientific and medical applications. Its role as a protecting group and precursor in synthesis processes is crucial for the development of innovative compounds and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 16639-91-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,6,3 and 9 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 16639-91:
(7*1)+(6*6)+(5*6)+(4*3)+(3*9)+(2*9)+(1*1)=131
131 % 10 = 1
So 16639-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H12N2O5/c1-2-14-7(13)9-4(6(11)12)3-5(8)10/h4H,2-3H2,1H3,(H2,8,10)(H,9,13)(H,11,12)/t4-/m0/s1
