16639-91-1 Usage
General Description
N-(alpha)-ethoxycarbonyl-L-asparagine is a chemical compound that is a derivative of the amino acid asparagine. N(ALPHA)-ETHOXYCARBONYL-L-ASPARAGINE is commonly used in peptide synthesis as a protecting group for the carboxyl group of asparagine, allowing for selective modification of other amino acid residues in the peptide chain. It is also used as a precursor in the synthesis of various pharmaceutical and biologically active compounds. The ethoxycarbonyl group, or urethane group, serves as a temporary protective group during chemical reactions, which can be removed later to reveal the unaltered asparagine residue. N(ALPHA)-ETHOXYCARBONYL-L-ASPARAGINE plays a crucial role in the synthesis of peptides and other organic molecules for various scientific and medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 16639-91-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,6,3 and 9 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 16639-91:
(7*1)+(6*6)+(5*6)+(4*3)+(3*9)+(2*9)+(1*1)=131
131 % 10 = 1
So 16639-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H12N2O5/c1-2-14-7(13)9-4(6(11)12)3-5(8)10/h4H,2-3H2,1H3,(H2,8,10)(H,9,13)(H,11,12)/t4-/m0/s1
