1669-86-9 Usage
Uses
Used in Pharmaceutical Industry:
N-[2-(1H-imidazol-4-yl)ethyl]-1H-adenine is used as a potential ligand for certain proteins or receptors in the pharmaceutical industry. Its imidazole group allows it to form coordinate bonds with metal ions or hydrogen bonds with amino acid residues, which can be utilized in the development of new drugs or therapies.
Used in Research and Development:
N-[2-(1H-imidazol-4-yl)ethyl]-1H-adenine is used as a research compound for studying its potential biological activity and structural properties. Its structural similarity to adenine, a component of DNA and RNA, makes it a valuable tool for understanding the interactions between nucleobases and other biomolecules.
Used in Chemical Synthesis:
N-[2-(1H-imidazol-4-yl)ethyl]-1H-adenine can be used as a starting material or intermediate in the synthesis of other related compounds with potential applications in various industries, such as pharmaceuticals, agrochemicals, or materials science. Its unique structure and functional groups make it a versatile building block for the development of new molecules with specific properties or functions.
Check Digit Verification of cas no
The CAS Registry Mumber 1669-86-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,6 and 9 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1669-86:
(6*1)+(5*6)+(4*6)+(3*9)+(2*8)+(1*6)=109
109 % 10 = 9
So 1669-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N7/c1(7-3-11-4-13-7)2-12-9-8-10(15-5-14-8)17-6-16-9/h3-6,8H,1-2H2,(H,11,13)(H,12,14,15,16,17)