1669-86-9 Usage
General Description
N-[2-(1H-imidazol-4-yl)ethyl]-1H-adenine is a chemical compound that is a derivative of the nucleobase adenine. It contains an imidazole group and an ethyl chain attached to the nitrogen atom at position 2 of the adenine ring. N-[2-(1H-imidazol-4-yl)ethyl]-1H-adenine is a potential ligand for certain proteins or receptors due to its imidazole group, which has the ability to form coordinate bonds with metal ions or hydrogen bonds with amino acid residues. It may also have potential biological activity due to its structural similarity to adenine, a component of DNA and RNA. Further research is needed to fully understand the properties and potential applications of N-[2-(1H-imidazol-4-yl)ethyl]-1H-adenine.
Check Digit Verification of cas no
The CAS Registry Mumber 1669-86-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,6 and 9 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1669-86:
(6*1)+(5*6)+(4*6)+(3*9)+(2*8)+(1*6)=109
109 % 10 = 9
So 1669-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N7/c1(7-3-11-4-13-7)2-12-9-8-10(15-5-14-8)17-6-16-9/h3-6,8H,1-2H2,(H,11,13)(H,12,14,15,16,17)