16690-44-1 Usage
Description
N-(7-Methoxy-9H-fluoren-2-yl)acetamide is a chemical compound characterized by the molecular formula C16H15NO2. It features an amide functional group and a fluorene moiety with a methoxy group at the 7-position. N-(7-Methoxy-9H-fluoren-2-yl)acetamide is widely utilized in organic synthesis and medicinal chemistry as a fundamental building block for constructing more complex molecules. Its distinctive structural attributes and properties render it highly suitable for applications across the pharmaceutical and materials science sectors. Moreover, the amide functional group endows it with potential biological activity, positioning it as a significant compound for research and development in the realms of drug discovery and design.
Uses
Used in Organic Synthesis:
N-(7-Methoxy-9H-fluoren-2-yl)acetamide is employed as a synthetic intermediate for the creation of more complex organic molecules. Its unique structure allows for versatile chemical reactions, facilitating the synthesis of a broad range of compounds.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, N-(7-Methoxy-9H-fluoren-2-yl)acetamide is used as a key component in the development of pharmaceuticals. Its incorporation into drug molecules can potentially enhance their efficacy, selectivity, and pharmacokinetic properties.
Used in Pharmaceutical Industry:
N-(7-Methoxy-9H-fluoren-2-yl)acetamide is utilized as a building block for the synthesis of new drug candidates. Its presence in molecular structures can contribute to the discovery of novel therapeutic agents with improved pharmacological profiles.
Used in Materials Science:
Within the materials science industry, N-(7-Methoxy-9H-fluoren-2-yl)acetamide is applied in the development of advanced materials with specific properties. Its integration into material compositions can lead to the creation of innovative products with applications in various technological fields.
Used in Drug Discovery and Design:
N-(7-Methoxy-9H-fluoren-2-yl)acetamide is leveraged in the research and development of new drugs. Its potential biological activity and structural features make it a valuable compound for exploring and designing pharmaceutical agents with targeted therapeutic effects.
Check Digit Verification of cas no
The CAS Registry Mumber 16690-44-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,6,9 and 0 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 16690-44:
(7*1)+(6*6)+(5*6)+(4*9)+(3*0)+(2*4)+(1*4)=121
121 % 10 = 1
So 16690-44-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H15NO2/c1-10(18)17-13-3-5-15-11(8-13)7-12-9-14(19-2)4-6-16(12)15/h3-6,8-9H,7H2,1-2H3,(H,17,18)
