16709-23-2 Usage
General Description
Argininamide is a chemical compound that is the amide derivative of the amino acid arginine. It is also known as L-arginylamide and has the molecular formula C6H15N5O. Argininamide is a basic amino acid and plays a significant role in various biochemical processes in the body. It acts as a precursor for the synthesis of proteins, nitric oxide, creatine, and other important molecules. Additionally, argininamide is involved in the urea cycle, which is responsible for the removal of ammonia from the body. argininamide has also been studied for its potential therapeutic uses, particularly in the treatment of cardiovascular diseases and in enhancing athletic performance.
Check Digit Verification of cas no
The CAS Registry Mumber 16709-23-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,7,0 and 9 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 16709-23:
(7*1)+(6*6)+(5*7)+(4*0)+(3*9)+(2*2)+(1*3)=112
112 % 10 = 2
So 16709-23-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H15N5O/c7-4(5(8)12)2-1-3-11-6(9)10/h4H,1-3,7H2,(H2,8,12)(H4,9,10,11)
