16715-83-6 Usage
General Description
2-Diisopropylaminoethyl methacrylate is a chemical compound that belongs to the class of methacrylate monomers. It is a clear, colorless liquid with a mild odor and is soluble in water. 2-DIISOPROPYLAMINOETHYL METHACRYLATE is commonly used in the production of polymers and copolymers for various industrial applications, such as adhesives, coatings, and sealants. Its unique chemical structure, which includes a diisopropylaminoethyl group, allows for improved adhesion and compatibility with other materials. Additionally, 2-diisopropylaminoethyl methacrylate is known for its low toxicity and low volatility, making it a versatile and safe ingredient for use in various formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 16715-83-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,7,1 and 5 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 16715-83:
(7*1)+(6*6)+(5*7)+(4*1)+(3*5)+(2*8)+(1*3)=116
116 % 10 = 6
So 16715-83-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H23NO2/c1-9(2)12(14)15-8-7-13(10(3)4)11(5)6/h10-11H,1,7-8H2,2-6H3
