16757-86-1 Usage
Type of compound
Polycyclic aromatic hydrocarbon (PAH)
Formation
Incomplete combustion of organic materials (e.g., tobacco smoke, vehicle emissions)
+ Potent carcinogen
Causes cancer in living tissues
+ Mutagen
Causes changes in the DNA sequence
+ DNA damage
Can lead to various types of cancer (e.g., lung, skin, bladder cancer)
+ Inhalation
Contaminated air
+ Ingestion
Contaminated food and water
Environmental impact
Significant pollutant
Monitoring
Closely monitored due to toxicity and health risks
Health risks
Potential harm to humans and other organisms
+ Stricter regulations
Air and water pollution
+ Technological development
Minimize formation during combustion processes
Check Digit Verification of cas no
The CAS Registry Mumber 16757-86-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,7,5 and 7 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 16757-86:
(7*1)+(6*6)+(5*7)+(4*5)+(3*7)+(2*8)+(1*6)=141
141 % 10 = 1
So 16757-86-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H16/c1-13-11-14(2)18-9-10-20-19-6-4-3-5-15(19)12-16-7-8-17(13)22(18)21(16)20/h3-12H,1-2H3