168080-49-7 Usage
Uses
Used in Pharmaceutical Development:
2-chloro-4-(5-fluoro-2-methylbenzamido)benzoic acid is used as a chemical intermediate for the synthesis of pharmaceutical drugs. Its unique molecular structure, which includes electronegative halogens and a carboxylic acid group, makes it a promising candidate for the development of new medications.
Used in Organic Synthesis:
2-chloro-4-(5-fluoro-2-methylbenzamido)benzoic acid is used as a reagent in organic synthesis reactions. The presence of different functional groups, such as the benzamide and carboxylic acid groups, allows for a range of chemical reactions, making it a versatile compound for creating various organic molecules.
Used in Chemical Research:
2-chloro-4-(5-fluoro-2-methylbenzamido)benzoic acid is used as a subject of study in chemical research. Its distinct molecular structure and the presence of halogens and other functional groups provide opportunities for investigating its chemical behavior, reactivity, and potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 168080-49-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,8,0,8 and 0 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 168080-49:
(8*1)+(7*6)+(6*8)+(5*0)+(4*8)+(3*0)+(2*4)+(1*9)=147
147 % 10 = 7
So 168080-49-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H11ClFNO3/c1-8-2-3-9(17)6-12(8)14(19)18-10-4-5-11(15(20)21)13(16)7-10/h2-7H,1H3,(H,18,19)(H,20,21)
