1687-52-1 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
2-AMINO-6-METHYLQUINAZOLINE is used as a building block for the synthesis of various pharmaceuticals and agrochemicals, due to its ability to be incorporated into complex molecular structures that can exhibit therapeutic or pesticidal properties.
Used in Anticancer Research:
2-AMINO-6-METHYLQUINAZOLINE is used as a potential anticancer agent, being studied for its ability to target and affect cancer cells, offering a new avenue for the development of cancer treatments.
Used in Material Development:
2-AMINO-6-METHYLQUINAZOLINE is used in the development of new materials, leveraging its chemical properties to create innovative substances with unique characteristics for various applications.
Used in Coordination Chemistry:
2-AMINO-6-METHYLQUINAZOLINE is used as a ligand in coordination chemistry, where it can form complexes with metal ions, potentially leading to new catalysts or materials with specialized functions.
Check Digit Verification of cas no
The CAS Registry Mumber 1687-52-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,8 and 7 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1687-52:
(6*1)+(5*6)+(4*8)+(3*7)+(2*5)+(1*2)=101
101 % 10 = 1
So 1687-52-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3/c1-6-2-3-8-7(4-6)5-11-9(10)12-8/h2-5H,1H3,(H2,10,11,12)
