16878-76-5 Usage
Uses
Used in Pharmaceutical Applications:
Pteridine-2-thiol is used as a precursor for the synthesis of various organic compounds, contributing to the development of new drugs and pharmaceuticals. Its unique structure and chemical properties make it a valuable component in the creation of novel therapeutic agents.
Used in Medicinal Chemistry Research:
Pteridine-2-thiol is used as a research compound in medicinal chemistry, where its unique structure and properties are studied to understand its potential interactions with biological systems and its role in the development of new pharmaceuticals.
Used in Biochemistry Applications:
In the field of biochemistry, Pteridine-2-thiol is used to study its potential biological applications, such as its interactions with enzymes, proteins, and other biomolecules, which may lead to the discovery of new biological functions and therapeutic targets.
Used in Organic Chemistry Synthesis:
Pteridine-2-thiol is used as a key intermediate in the synthesis of various organic compounds, leveraging its unique thiol functional group for the formation of new chemical bonds and the creation of novel molecules with potential applications in various industries.
Used in Materials Science:
Pteridine-2-thiol may have potential uses in materials science, where its unique structure and properties can be utilized to develop new materials with specific characteristics, such as improved stability, reactivity, or selectivity in various applications.
Used as a Catalyst in Chemical Reactions:
Due to its unique chemical properties, Pteridine-2-thiol may be used as a catalyst in various chemical reactions, enhancing the efficiency and selectivity of these processes and contributing to the development of more sustainable and environmentally friendly chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 16878-76-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,8,7 and 8 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 16878-76:
(7*1)+(6*6)+(5*8)+(4*7)+(3*8)+(2*7)+(1*6)=155
155 % 10 = 5
So 16878-76-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H4N4S/c11-6-9-3-4-5(10-6)8-2-1-7-4/h1-3H,(H,8,9,10,11)
