16879-39-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-4,6-dimethylpyrimidine is used as a building block in organic synthesis for the production of various drug molecules. Its unique structure allows for the creation of biologically active molecules, contributing to the development of new pharmaceuticals.
Used in Agrochemical Industry:
2-Bromo-4,6-dimethylpyrimidine is used as an intermediate in the synthesis of agrochemicals. Its chemical properties make it suitable for the development of effective compounds used in agriculture.
Used in Dye Industry:
2-Bromo-4,6-dimethylpyrimidine is utilized in the synthesis of dyes, where its bromine atom and pyrimidine structure contribute to the color and properties of the resulting dyes.
Used in Fine Chemicals Industry:
2-Bromo-4,6-dimethylpyrimidine is employed as a versatile chemical intermediate in the production of various fine chemicals. Its reactivity and structural features make it a valuable component in the synthesis of specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 16879-39-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,8,7 and 9 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 16879-39:
(7*1)+(6*6)+(5*8)+(4*7)+(3*9)+(2*3)+(1*9)=153
153 % 10 = 3
So 16879-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BrN2/c1-4-3-5(2)9-6(7)8-4/h3H,1-2H3
