16901-37-4 Usage
General Description
1-(4-fluorophenyl)semicarbazide is a chemical compound consisting of a semicarbazide group attached to a phenyl ring with a fluorine substituent at the 4-position. It is commonly used as a reagent in organic synthesis and can also act as a ligand in coordination chemistry. The compound has potential applications in pharmaceuticals and agrochemicals due to its ability to form complexes with various metal ions. Additionally, 1-(4-fluorophenyl)semicarbazide has been studied for its potential antitumor and antiviral activities, making it a compound of interest for medicinal chemistry research. Its properties and potential applications make it an important compound for the development of new drugs and chemical technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 16901-37-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,9,0 and 1 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 16901-37:
(7*1)+(6*6)+(5*9)+(4*0)+(3*1)+(2*3)+(1*7)=104
104 % 10 = 4
So 16901-37-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H8FN3O/c8-5-1-3-6(4-2-5)10-11-7(9)12/h1-4,10H,(H3,9,11,12)