16907-79-2 Usage
General Description
Quinaldic acid sodium salt, also known as sodium quinaldate, is a chemical compound that is commonly used as a complexing agent in the analysis of metals and metal ions. It is a derivative of quinaldic acid, a heterocyclic compound that contains a quinoline ring. The sodium salt form is water-soluble and stable, making it an effective reagent for the determination and separation of various metal ions, including iron, copper, and zinc. It is often used in analytical chemistry and research laboratories for its ability to form stable complexes with metal ions, allowing for their isolation and identification. Additionally, quinaldic acid sodium salt has been employed in pharmaceutical research and in the synthesis of certain organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 16907-79-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,9,0 and 7 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 16907-79:
(7*1)+(6*6)+(5*9)+(4*0)+(3*7)+(2*7)+(1*9)=132
132 % 10 = 2
So 16907-79-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H7NO2.Na/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H,12,13);/q;+1/p-1
