1692-45-1 Usage
General Description
2,3-dihydro-2-phenyl-4-benzopyrone (2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone is a chemical compound that belongs to the class of hydrazones. It is derived from 2,3-dihydro-2-phenyl-4-benzopyrone and has a hydrazone functional group attached to its structure. 2,3-dihydro-2-phenyl-4-benzopyrone (2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone has been studied for its potential biological activities, including its antimicrobial, antioxidant, and anti-inflammatory properties. It has also been explored for its potential applications in pharmaceuticals and materials science due to its unique chemical structure. Overall, 2,3-dihydro-2-phenyl-4-benzopyrone hydrazone is a versatile compound with potential uses in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 1692-45-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,9 and 2 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1692-45:
(6*1)+(5*6)+(4*9)+(3*2)+(2*4)+(1*5)=91
91 % 10 = 1
So 1692-45-1 is a valid CAS Registry Number.
InChI:InChI=1/C30H24N2O2/c1-3-11-21(12-4-1)29-19-25(23-15-7-9-17-27(23)33-29)31-32-26-20-30(22-13-5-2-6-14-22)34-28-18-10-8-16-24(26)28/h1-18,29-30H,19-20H2/b31-25-,32-26+